C16H10F6O — CID 24726630
1-[3-(trifluoromethyl)phenyl]-3-(3,4,5-trifluorophenyl)propan-1-one (PubChem CID 24726630) has the molecular formula C16H10F6O and a molecular weight of 332.24 g/mol. Its IUPAC name is 1-[3-(trifluoromethyl)phenyl]-3-(3,4,5-trifluorophenyl)propan-1-one.
| Compound Name | 1-[3-(trifluoromethyl)phenyl]-3-(3,4,5-trifluorophenyl)propan-1-one |
|---|---|
| PubChem CID | 24726630 |
| Molecular Formula | C16H10F6O |
| Molecular Weight | 332.24 g/mol |
| Exact Mass | 332.06 |
| IUPAC Name | 1-[3-(trifluoromethyl)phenyl]-3-(3,4,5-trifluorophenyl)propan-1-one |
| SMILES | O=C(CCc1cc(F)c(F)c(F)c1)c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C16H10F6O/c17-12-6-9(7-13(18)15(12)19)4-5-14(23)10-2-1-3-11(8-10)16(20,21)22/h1-3,6-8H,4-5H2 |
| InChIKey | WEFXBLXXAGWBPO-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.24 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|