About [(E)-oct-3-en-2-yl] 3-(trifluoromethyl)benzoate
[(E)-oct-3-en-2-yl] 3-(trifluoromethyl)benzoate (PubChem CID 5353140) has the molecular formula C16H19F3O2
and a molecular weight of 300.32 g/mol. Its IUPAC name is [(E)-oct-3-en-2-yl] 3-(trifluoromethyl)benzoate.
Molecular Properties
| Compound Name | [(E)-oct-3-en-2-yl] 3-(trifluoromethyl)benzoate |
| PubChem CID | 5353140 |
| Molecular Formula | C16H19F3O2 |
| Molecular Weight | 300.32 g/mol |
| Exact Mass | 300.13 |
| IUPAC Name | [(E)-oct-3-en-2-yl] 3-(trifluoromethyl)benzoate |
| SMILES | CCCC/C=C/C(C)OC(=O)c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C16H19F3O2/c1-3-4-5-6-8-12(2)21-15(20)13-9-7-10-14(11-13)16(17,18)19/h6-12H,3-5H2,1-2H3/b8-6+ |
| InChIKey | CURIZVLIDWVEPQ-SOFGYWHQSA-N |
| XLogP | 5.00 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 300.32 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze [(E)-oct-3-en-2-yl] 3-(trifluoromethyl)benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(E)-oct-3-en-2-yl] 3-(trifluoromethyl)benzoate?
The IUPAC name of [(E)-oct-3-en-2-yl] 3-(trifluoromethyl)benzoate (CID 5353140) is [(E)-oct-3-en-2-yl] 3-(trifluoromethyl)benzoate.
What is the SMILES notation for [(E)-oct-3-en-2-yl] 3-(trifluoromethyl)benzoate?
The canonical SMILES for [(E)-oct-3-en-2-yl] 3-(trifluoromethyl)benzoate is CCCC/C=C/C(C)OC(=O)c1cccc(C(F)(F)F)c1.
What is the InChIKey of [(E)-oct-3-en-2-yl] 3-(trifluoromethyl)benzoate?
The InChIKey is CURIZVLIDWVEPQ-SOFGYWHQSA-N. The full InChI is InChI=1S/C16H19F3O2/c1-3-4-5-6-8-12(2)21-15(20)13-9-7-10-14(11-13)16(17,18)19/h6-12H,3-5H2,1-2H3/b8-6+.
What are the key properties of [(E)-oct-3-en-2-yl] 3-(trifluoromethyl)benzoate?
[(E)-oct-3-en-2-yl] 3-(trifluoromethyl)benzoate has a molecular weight of 300.32 g/mol, XLogP of 5.00, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [(E)-oct-3-en-2-yl] 3-(trifluoromethyl)benzoate is sourced from PubChem (CID 5353140), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).