C21H19FN2O4S — CID 85335184
methyl 2-[2-[[2-(2-fluorophenyl)-5-methyl-1,3-thiazol-4-yl]oxymethyl]phenyl]-2-methoxyiminoacetate (PubChem CID 85335184) has the molecular formula C21H19FN2O4S and a molecular weight of 414.46 g/mol. Its IUPAC name is methyl 2-[2-[[2-(2-fluorophenyl)-5-methyl-1,3-thiazol-4-yl]oxymethyl]phenyl]-2-methoxyiminoacetate.
| Compound Name | methyl 2-[2-[[2-(2-fluorophenyl)-5-methyl-1,3-thiazol-4-yl]oxymethyl]phenyl]-2-methoxyiminoacetate |
|---|---|
| PubChem CID | 85335184 |
| Molecular Formula | C21H19FN2O4S |
| Molecular Weight | 414.46 g/mol |
| Exact Mass | 414.10 |
| IUPAC Name | methyl 2-[2-[[2-(2-fluorophenyl)-5-methyl-1,3-thiazol-4-yl]oxymethyl]phenyl]-2-methoxyiminoacetate |
| SMILES | CON=C(C(=O)OC)c1ccccc1COc1nc(-c2ccccc2F)sc1C |
| InChI | InChI=1S/C21H19FN2O4S/c1-13-19(23-20(29-13)16-10-6-7-11-17(16)22)28-12-14-8-4-5-9-15(14)18(24-27-3)21(25)26-2/h4-11H,12H2,1-3H3 |
| InChIKey | WGEOJUUJRAHNHR-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 70.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.46 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|