C20H27N3O4 — CID 172952412
ethane;methyl (2E)-2-methoxyimino-2-[2-[(2,5,6-trimethylpyrimidin-4-yl)oxymethyl]phenyl]acetate (PubChem CID 172952412) has the molecular formula C20H27N3O4 and a molecular weight of 373.45 g/mol. Its IUPAC name is ethane;methyl (2E)-2-methoxyimino-2-[2-[(2,5,6-trimethylpyrimidin-4-yl)oxymethyl]phenyl]acetate.
| Compound Name | ethane;methyl (2E)-2-methoxyimino-2-[2-[(2,5,6-trimethylpyrimidin-4-yl)oxymethyl]phenyl]acetate |
|---|---|
| PubChem CID | 172952412 |
| Molecular Formula | C20H27N3O4 |
| Molecular Weight | 373.45 g/mol |
| Exact Mass | 373.20 |
| IUPAC Name | ethane;methyl (2E)-2-methoxyimino-2-[2-[(2,5,6-trimethylpyrimidin-4-yl)oxymethyl]phenyl]acetate |
| SMILES | CC.CO/N=C(/C(=O)OC)c1ccccc1COc1nc(C)nc(C)c1C |
| InChI | InChI=1S/C18H21N3O4.C2H6/c1-11-12(2)19-13(3)20-17(11)25-10-14-8-6-7-9-15(14)16(21-24-5)18(22)23-4;1-2/h6-9H,10H2,1-5H3;1-2H3/b21-16+; |
| InChIKey | KKFIBXKXKKKFDY-JEBHESKQSA-N |
| XLogP | 3.53 |
| TPSA | 82.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.45 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|