C20H19Cl2NO4 — CID 87559356
methyl (2E)-2-[2-[[2-(2,2-dichloroethenyl)-6-methylphenoxy]methyl]phenyl]-2-methoxyiminoacetate (PubChem CID 87559356) has the molecular formula C20H19Cl2NO4 and a molecular weight of 408.28 g/mol. Its IUPAC name is methyl (2E)-2-[2-[[2-(2,2-dichloroethenyl)-6-methylphenoxy]methyl]phenyl]-2-methoxyiminoacetate.
| Compound Name | methyl (2E)-2-[2-[[2-(2,2-dichloroethenyl)-6-methylphenoxy]methyl]phenyl]-2-methoxyiminoacetate |
|---|---|
| PubChem CID | 87559356 |
| Molecular Formula | C20H19Cl2NO4 |
| Molecular Weight | 408.28 g/mol |
| Exact Mass | 407.07 |
| IUPAC Name | methyl (2E)-2-[2-[[2-(2,2-dichloroethenyl)-6-methylphenoxy]methyl]phenyl]-2-methoxyiminoacetate |
| SMILES | CO/N=C(/C(=O)OC)c1ccccc1COc1c(C)cccc1C=C(Cl)Cl |
| InChI | InChI=1S/C20H19Cl2NO4/c1-13-7-6-9-14(11-17(21)22)19(13)27-12-15-8-4-5-10-16(15)18(23-26-3)20(24)25-2/h4-11H,12H2,1-3H3/b23-18+ |
| InChIKey | JFCUERSTEIEITM-PTGBLXJZSA-N |
| XLogP | 4.87 |
| TPSA | 57.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.28 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|