C19H16Cl3NO4 — CID 87558796
methyl (2E)-2-[2-[[3-chloro-4-(2,2-dichloroethenyl)phenoxy]methyl]phenyl]-2-methoxyiminoacetate (PubChem CID 87558796) has the molecular formula C19H16Cl3NO4 and a molecular weight of 428.70 g/mol. Its IUPAC name is methyl (2E)-2-[2-[[3-chloro-4-(2,2-dichloroethenyl)phenoxy]methyl]phenyl]-2-methoxyiminoacetate.
| Compound Name | methyl (2E)-2-[2-[[3-chloro-4-(2,2-dichloroethenyl)phenoxy]methyl]phenyl]-2-methoxyiminoacetate |
|---|---|
| PubChem CID | 87558796 |
| Molecular Formula | C19H16Cl3NO4 |
| Molecular Weight | 428.70 g/mol |
| Exact Mass | 427.01 |
| IUPAC Name | methyl (2E)-2-[2-[[3-chloro-4-(2,2-dichloroethenyl)phenoxy]methyl]phenyl]-2-methoxyiminoacetate |
| SMILES | CO/N=C(/C(=O)OC)c1ccccc1COc1ccc(C=C(Cl)Cl)c(Cl)c1 |
| InChI | InChI=1S/C19H16Cl3NO4/c1-25-19(24)18(23-26-2)15-6-4-3-5-13(15)11-27-14-8-7-12(9-17(21)22)16(20)10-14/h3-10H,11H2,1-2H3/b23-18+ |
| InChIKey | SBFXHNRNUIMAJF-PTGBLXJZSA-N |
| XLogP | 5.22 |
| TPSA | 57.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.70 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|