C19H20N4O4S — CID 173278398
3-methoxy-2-[2-[[2-(5-methyl-[1,3]thiazolo[3,2-b][1,2,4]triazol-6-yl)ethylideneamino]oxymethyl]phenyl]but-2-enoic acid (PubChem CID 173278398) has the molecular formula C19H20N4O4S and a molecular weight of 400.46 g/mol. Its IUPAC name is 3-methoxy-2-[2-[[2-(5-methyl-[1,3]thiazolo[3,2-b][1,2,4]triazol-6-yl)ethylideneamino]oxymethyl]phenyl]but-2-enoic acid.
| Compound Name | 3-methoxy-2-[2-[[2-(5-methyl-[1,3]thiazolo[3,2-b][1,2,4]triazol-6-yl)ethylideneamino]oxymethyl]phenyl]but-2-enoic acid |
|---|---|
| PubChem CID | 173278398 |
| Molecular Formula | C19H20N4O4S |
| Molecular Weight | 400.46 g/mol |
| Exact Mass | 400.12 |
| IUPAC Name | 3-methoxy-2-[2-[[2-(5-methyl-[1,3]thiazolo[3,2-b][1,2,4]triazol-6-yl)ethylideneamino]oxymethyl]phenyl]but-2-enoic acid |
| SMILES | COC(C)=C(C(=O)O)c1ccccc1CON=CCc1c(C)sc2ncnn12 |
| InChI | InChI=1S/C19H20N4O4S/c1-12(26-3)17(18(24)25)15-7-5-4-6-14(15)10-27-22-9-8-16-13(2)28-19-20-11-21-23(16)19/h4-7,9,11H,8,10H2,1-3H3,(H,24,25) |
| InChIKey | YPMZIRDKHOVANN-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 98.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.46 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|