C25H19Cl2F3O5 — CID 69304211
2-[2-[[3,5-dichloro-4-[4-(trifluoromethyl)phenoxy]phenoxy]methyl]phenyl]-3-methoxybut-2-enoic acid (PubChem CID 69304211) has the molecular formula C25H19Cl2F3O5 and a molecular weight of 527.32 g/mol. Its IUPAC name is 2-[2-[[3,5-dichloro-4-[4-(trifluoromethyl)phenoxy]phenoxy]methyl]phenyl]-3-methoxybut-2-enoic acid.
| Compound Name | 2-[2-[[3,5-dichloro-4-[4-(trifluoromethyl)phenoxy]phenoxy]methyl]phenyl]-3-methoxybut-2-enoic acid |
|---|---|
| PubChem CID | 69304211 |
| Molecular Formula | C25H19Cl2F3O5 |
| Molecular Weight | 527.32 g/mol |
| Exact Mass | 526.06 |
| IUPAC Name | 2-[2-[[3,5-dichloro-4-[4-(trifluoromethyl)phenoxy]phenoxy]methyl]phenyl]-3-methoxybut-2-enoic acid |
| SMILES | COC(C)=C(C(=O)O)c1ccccc1COc1cc(Cl)c(Oc2ccc(C(F)(F)F)cc2)c(Cl)c1 |
| InChI | InChI=1S/C25H19Cl2F3O5/c1-14(33-2)22(24(31)32)19-6-4-3-5-15(19)13-34-18-11-20(26)23(21(27)12-18)35-17-9-7-16(8-10-17)25(28,29)30/h3-12H,13H2,1-2H3,(H,31,32) |
| InChIKey | PMARNBCQNFVZTI-UHFFFAOYSA-N |
| XLogP | 7.85 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.32 |
| LogP ≤ 5 | 7.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|