C21H18Cl4O5 — CID 173157158
2-[2-[[3,5-dichloro-4-(3,3-dichloroprop-2-enoxy)phenoxy]methyl]phenyl]-3-methoxybut-2-enoic acid (PubChem CID 173157158) has the molecular formula C21H18Cl4O5 and a molecular weight of 492.18 g/mol. Its IUPAC name is 2-[2-[[3,5-dichloro-4-(3,3-dichloroprop-2-enoxy)phenoxy]methyl]phenyl]-3-methoxybut-2-enoic acid.
| Compound Name | 2-[2-[[3,5-dichloro-4-(3,3-dichloroprop-2-enoxy)phenoxy]methyl]phenyl]-3-methoxybut-2-enoic acid |
|---|---|
| PubChem CID | 173157158 |
| Molecular Formula | C21H18Cl4O5 |
| Molecular Weight | 492.18 g/mol |
| Exact Mass | 489.99 |
| IUPAC Name | 2-[2-[[3,5-dichloro-4-(3,3-dichloroprop-2-enoxy)phenoxy]methyl]phenyl]-3-methoxybut-2-enoic acid |
| SMILES | COC(C)=C(C(=O)O)c1ccccc1COc1cc(Cl)c(OCC=C(Cl)Cl)c(Cl)c1 |
| InChI | InChI=1S/C21H18Cl4O5/c1-12(28-2)19(21(26)27)15-6-4-3-5-13(15)11-30-14-9-16(22)20(17(23)10-14)29-8-7-18(24)25/h3-7,9-10H,8,11H2,1-2H3,(H,26,27) |
| InChIKey | RGFIWSFKACLCKK-UHFFFAOYSA-N |
| XLogP | 6.73 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.18 |
| LogP ≤ 5 | 6.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|