C20H15BrCl2F3NO5 — CID 87949247
(2E)-2-[2-[[4-(3-bromo-4,4,4-trifluorobut-2-enoxy)-3,5-dichlorophenoxy]methyl]phenyl]-2-methoxyiminoacetic acid (PubChem CID 87949247) has the molecular formula C20H15BrCl2F3NO5 and a molecular weight of 557.15 g/mol. Its IUPAC name is (2E)-2-[2-[[4-(3-bromo-4,4,4-trifluorobut-2-enoxy)-3,5-dichlorophenoxy]methyl]phenyl]-2-methoxyiminoacetic acid.
| Compound Name | (2E)-2-[2-[[4-(3-bromo-4,4,4-trifluorobut-2-enoxy)-3,5-dichlorophenoxy]methyl]phenyl]-2-methoxyiminoacetic acid |
|---|---|
| PubChem CID | 87949247 |
| Molecular Formula | C20H15BrCl2F3NO5 |
| Molecular Weight | 557.15 g/mol |
| Exact Mass | 554.95 |
| IUPAC Name | (2E)-2-[2-[[4-(3-bromo-4,4,4-trifluorobut-2-enoxy)-3,5-dichlorophenoxy]methyl]phenyl]-2-methoxyiminoacetic acid |
| SMILES | CO/N=C(/C(=O)O)c1ccccc1COc1cc(Cl)c(OCC=C(Br)C(F)(F)F)c(Cl)c1 |
| InChI | InChI=1S/C20H15BrCl2F3NO5/c1-30-27-17(19(28)29)13-5-3-2-4-11(13)10-32-12-8-14(22)18(15(23)9-12)31-7-6-16(21)20(24,25)26/h2-6,8-9H,7,10H2,1H3,(H,28,29)/b16-6?,27-17+ |
| InChIKey | RDDVTRAXIAQZST-WMIYIQEHSA-N |
| XLogP | 6.23 |
| TPSA | 77.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.15 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|