C26H24Cl2O6 — CID 69303441
2-[2-[[3,5-dichloro-4-[(4-methoxyphenyl)methoxy]phenoxy]methyl]phenyl]-3-methoxybut-2-enoic acid (PubChem CID 69303441) has the molecular formula C26H24Cl2O6 and a molecular weight of 503.38 g/mol. Its IUPAC name is 2-[2-[[3,5-dichloro-4-[(4-methoxyphenyl)methoxy]phenoxy]methyl]phenyl]-3-methoxybut-2-enoic acid.
| Compound Name | 2-[2-[[3,5-dichloro-4-[(4-methoxyphenyl)methoxy]phenoxy]methyl]phenyl]-3-methoxybut-2-enoic acid |
|---|---|
| PubChem CID | 69303441 |
| Molecular Formula | C26H24Cl2O6 |
| Molecular Weight | 503.38 g/mol |
| Exact Mass | 502.09 |
| IUPAC Name | 2-[2-[[3,5-dichloro-4-[(4-methoxyphenyl)methoxy]phenoxy]methyl]phenyl]-3-methoxybut-2-enoic acid |
| SMILES | COC(C)=C(C(=O)O)c1ccccc1COc1cc(Cl)c(OCc2ccc(OC)cc2)c(Cl)c1 |
| InChI | InChI=1S/C26H24Cl2O6/c1-16(31-2)24(26(29)30)21-7-5-4-6-18(21)15-33-20-12-22(27)25(23(28)13-20)34-14-17-8-10-19(32-3)11-9-17/h4-13H,14-15H2,1-3H3,(H,29,30) |
| InChIKey | DOOCHTGSDSUHSS-UHFFFAOYSA-N |
| XLogP | 6.62 |
| TPSA | 74.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.38 |
| LogP ≤ 5 | 6.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|