About CID 140694349
CID 140694349 (PubChem CID 140694349) has the molecular formula C24H22BClO7
and a molecular weight of 468.70 g/mol.
Molecular Properties
| Compound Name | CID 140694349 |
| PubChem CID | 140694349 |
| Molecular Formula | C24H22BClO7 |
| Molecular Weight | 468.70 g/mol |
| Exact Mass | 468.11 |
| IUPAC Name | — |
| SMILES | [B]OC(=O)c1c(OC)c(Cl)cc(OCc2ccc(OC)cc2)c1OCc1ccc(OC)cc1 |
| InChI | InChI=1S/C24H22BClO7/c1-28-17-8-4-15(5-9-17)13-31-20-12-19(26)22(30-3)21(24(27)33-25)23(20)32-14-16-6-10-18(29-2)11-7-16/h4-12H,13-14H2,1-3H3 |
| InChIKey | BAEWSSDFEPUUKG-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 72.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 468.70 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 140694349 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 140694349?
The IUPAC name of CID 140694349 (CID 140694349) is not available.
What is the SMILES notation for CID 140694349?
The canonical SMILES for CID 140694349 is [B]OC(=O)c1c(OC)c(Cl)cc(OCc2ccc(OC)cc2)c1OCc1ccc(OC)cc1.
What is the InChIKey of CID 140694349?
The InChIKey is BAEWSSDFEPUUKG-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H22BClO7/c1-28-17-8-4-15(5-9-17)13-31-20-12-19(26)22(30-3)21(24(27)33-25)23(20)32-14-16-6-10-18(29-2)11-7-16/h4-12H,13-14H2,1-3H3.
What are the key properties of CID 140694349?
CID 140694349 has a molecular weight of 468.70 g/mol, XLogP of 4.76, 10 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for CID 140694349 is sourced from PubChem (CID 140694349), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).