C28H32O7 — CID 90090423
tert-butyl 6-methoxy-2,3-bis[(4-methoxyphenyl)methoxy]benzoate (PubChem CID 90090423) has the molecular formula C28H32O7 and a molecular weight of 480.56 g/mol. Its IUPAC name is tert-butyl 6-methoxy-2,3-bis[(4-methoxyphenyl)methoxy]benzoate.
| Compound Name | tert-butyl 6-methoxy-2,3-bis[(4-methoxyphenyl)methoxy]benzoate |
|---|---|
| PubChem CID | 90090423 |
| Molecular Formula | C28H32O7 |
| Molecular Weight | 480.56 g/mol |
| Exact Mass | 480.21 |
| IUPAC Name | tert-butyl 6-methoxy-2,3-bis[(4-methoxyphenyl)methoxy]benzoate |
| SMILES | COc1ccc(COc2ccc(OC)c(C(=O)OC(C)(C)C)c2OCc2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C28H32O7/c1-28(2,3)35-27(29)25-23(32-6)15-16-24(33-17-19-7-11-21(30-4)12-8-19)26(25)34-18-20-9-13-22(31-5)14-10-20/h7-16H,17-18H2,1-6H3 |
| InChIKey | JXSTYDVLRVPKKX-UHFFFAOYSA-N |
| XLogP | 5.83 |
| TPSA | 72.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.56 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |