C33H39ClN2O7 — CID 157141761
tert-butyl N-[2-[2-chloro-3,4-bis[(4-methoxyphenyl)methoxy]phenyl]-2-methyliminoacetyl]-N-propylcarbamate (PubChem CID 157141761) has the molecular formula C33H39ClN2O7 and a molecular weight of 611.14 g/mol. Its IUPAC name is tert-butyl N-[2-[2-chloro-3,4-bis[(4-methoxyphenyl)methoxy]phenyl]-2-methyliminoacetyl]-N-propylcarbamate.
| Compound Name | tert-butyl N-[2-[2-chloro-3,4-bis[(4-methoxyphenyl)methoxy]phenyl]-2-methyliminoacetyl]-N-propylcarbamate |
|---|---|
| PubChem CID | 157141761 |
| Molecular Formula | C33H39ClN2O7 |
| Molecular Weight | 611.14 g/mol |
| Exact Mass | 610.24 |
| IUPAC Name | tert-butyl N-[2-[2-chloro-3,4-bis[(4-methoxyphenyl)methoxy]phenyl]-2-methyliminoacetyl]-N-propylcarbamate |
| SMILES | CCCN(C(=O)OC(C)(C)C)C(=O)/C(=N\C)c1ccc(OCc2ccc(OC)cc2)c(OCc2ccc(OC)cc2)c1Cl |
| InChI | InChI=1S/C33H39ClN2O7/c1-8-19-36(32(38)43-33(2,3)4)31(37)29(35-5)26-17-18-27(41-20-22-9-13-24(39-6)14-10-22)30(28(26)34)42-21-23-11-15-25(40-7)16-12-23/h9-18H,8,19-21H2,1-7H3/b35-29- |
| InChIKey | QOWTYYCAZKJTET-MJPNWULPSA-N |
| XLogP | 7.11 |
| TPSA | 95.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 611.14 |
| LogP ≤ 5 | 7.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|