C57H55ClN2O10S2 — CID 142554328
tert-butyl N-[(2Z)-2-[2-chloro-3,4-bis[(4-methoxyphenyl)methoxy]phenyl]-2-trityloxyiminoacetyl]-N-[2-(4-methylphenyl)sulfonylsulfanylethyl]carbamate (PubChem CID 142554328) has the molecular formula C57H55ClN2O10S2 and a molecular weight of 1027.66 g/mol. Its IUPAC name is tert-butyl N-[(2Z)-2-[2-chloro-3,4-bis[(4-methoxyphenyl)methoxy]phenyl]-2-trityloxyiminoacetyl]-N-[2-(4-methylphenyl)sulfonylsulfanylethyl]carbamate.
| Compound Name | tert-butyl N-[(2Z)-2-[2-chloro-3,4-bis[(4-methoxyphenyl)methoxy]phenyl]-2-trityloxyiminoacetyl]-N-[2-(4-methylphenyl)sulfonylsulfanylethyl]carbamate |
|---|---|
| PubChem CID | 142554328 |
| Molecular Formula | C57H55ClN2O10S2 |
| Molecular Weight | 1027.66 g/mol |
| Exact Mass | 1026.30 |
| IUPAC Name | tert-butyl N-[(2Z)-2-[2-chloro-3,4-bis[(4-methoxyphenyl)methoxy]phenyl]-2-trityloxyiminoacetyl]-N-[2-(4-methylphenyl)sulfonylsulfanylethyl]carbamate |
| SMILES | COc1ccc(COc2ccc(/C(=N/OC(c3ccccc3)(c3ccccc3)c3ccccc3)C(=O)N(CCSS(=O)(=O)c3ccc(C)cc3)C(=O)OC(C)(C)C)c(Cl)c2OCc2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C57H55ClN2O10S2/c1-40-22-32-48(33-23-40)72(63,64)71-37-36-60(55(62)69-56(2,3)4)54(61)52(59-70-57(43-16-10-7-11-17-43,44-18-12-8-13-19-44)45-20-14-9-15-21-45)49-34-35-50(67-38-41-24-28-46(65-5)29-25-41)53(51(49)58)68-39-42-26-30-47(66-6)31-27-42/h7-35H,36-39H2,1-6H3/b59-52- |
| InChIKey | ZRNOJEDMDNGDMW-SIFVNYJGSA-N |
| XLogP | 12.42 |
| TPSA | 139.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 72 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1027.66 |
| LogP ≤ 5 | 12.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|