C43H37NO7 — CID 153349477
(2Z)-2-[3,4-bis[(4-methoxyphenyl)methoxy]phenyl]-2-trityloxyiminoacetic acid (PubChem CID 153349477) has the molecular formula C43H37NO7 and a molecular weight of 679.77 g/mol. Its IUPAC name is (2Z)-2-[3,4-bis[(4-methoxyphenyl)methoxy]phenyl]-2-trityloxyiminoacetic acid.
| Compound Name | (2Z)-2-[3,4-bis[(4-methoxyphenyl)methoxy]phenyl]-2-trityloxyiminoacetic acid |
|---|---|
| PubChem CID | 153349477 |
| Molecular Formula | C43H37NO7 |
| Molecular Weight | 679.77 g/mol |
| Exact Mass | 679.26 |
| IUPAC Name | (2Z)-2-[3,4-bis[(4-methoxyphenyl)methoxy]phenyl]-2-trityloxyiminoacetic acid |
| SMILES | COc1ccc(COc2ccc(/C(=N/OC(c3ccccc3)(c3ccccc3)c3ccccc3)C(=O)O)cc2OCc2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C43H37NO7/c1-47-37-23-18-31(19-24-37)29-49-39-27-22-33(28-40(39)50-30-32-20-25-38(48-2)26-21-32)41(42(45)46)44-51-43(34-12-6-3-7-13-34,35-14-8-4-9-15-35)36-16-10-5-11-17-36/h3-28H,29-30H2,1-2H3,(H,45,46)/b44-41- |
| InChIKey | IYAQFDFSCUFSRZ-OYDBNLDZSA-N |
| XLogP | 8.66 |
| TPSA | 95.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 679.77 |
| LogP ≤ 5 | 8.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|