C31H32O6 — CID 67742855
1-[3,4-bis[(4-methoxyphenyl)methoxy]phenyl]-1-phenylmethoxyethanol (PubChem CID 67742855) has the molecular formula C31H32O6 and a molecular weight of 500.59 g/mol. Its IUPAC name is 1-[3,4-bis[(4-methoxyphenyl)methoxy]phenyl]-1-phenylmethoxyethanol.
| Compound Name | 1-[3,4-bis[(4-methoxyphenyl)methoxy]phenyl]-1-phenylmethoxyethanol |
|---|---|
| PubChem CID | 67742855 |
| Molecular Formula | C31H32O6 |
| Molecular Weight | 500.59 g/mol |
| Exact Mass | 500.22 |
| IUPAC Name | 1-[3,4-bis[(4-methoxyphenyl)methoxy]phenyl]-1-phenylmethoxyethanol |
| SMILES | COc1ccc(COc2ccc(C(C)(O)OCc3ccccc3)cc2OCc2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C31H32O6/c1-31(32,37-22-23-7-5-4-6-8-23)26-13-18-29(35-20-24-9-14-27(33-2)15-10-24)30(19-26)36-21-25-11-16-28(34-3)17-12-25/h4-19,32H,20-22H2,1-3H3 |
| InChIKey | POYQKMIDSNDBCY-UHFFFAOYSA-N |
| XLogP | 6.24 |
| TPSA | 66.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.59 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|