C20H24O3 — CID 72521218
1-methoxy-4-(4-methoxy-2-methylbut-3-en-2-yl)-2-phenylmethoxybenzene (PubChem CID 72521218) has the molecular formula C20H24O3 and a molecular weight of 312.41 g/mol. Its IUPAC name is 1-methoxy-4-(4-methoxy-2-methylbut-3-en-2-yl)-2-phenylmethoxybenzene.
| Compound Name | 1-methoxy-4-(4-methoxy-2-methylbut-3-en-2-yl)-2-phenylmethoxybenzene |
|---|---|
| PubChem CID | 72521218 |
| Molecular Formula | C20H24O3 |
| Molecular Weight | 312.41 g/mol |
| Exact Mass | 312.17 |
| IUPAC Name | 1-methoxy-4-(4-methoxy-2-methylbut-3-en-2-yl)-2-phenylmethoxybenzene |
| SMILES | COC=CC(C)(C)c1ccc(OC)c(OCc2ccccc2)c1 |
| InChI | InChI=1S/C20H24O3/c1-20(2,12-13-21-3)17-10-11-18(22-4)19(14-17)23-15-16-8-6-5-7-9-16/h5-14H,15H2,1-4H3 |
| InChIKey | PFULQQPURNKKBD-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.41 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|