C33H34ClNO7S2 — CID 142554376
2-chloro-3,4-bis[(4-methoxyphenyl)methoxy]-N-methyl-N-[2-(4-methylphenyl)sulfonylsulfanylethyl]benzamide (PubChem CID 142554376) has the molecular formula C33H34ClNO7S2 and a molecular weight of 656.22 g/mol. Its IUPAC name is 2-chloro-3,4-bis[(4-methoxyphenyl)methoxy]-N-methyl-N-[2-(4-methylphenyl)sulfonylsulfanylethyl]benzamide.
| Compound Name | 2-chloro-3,4-bis[(4-methoxyphenyl)methoxy]-N-methyl-N-[2-(4-methylphenyl)sulfonylsulfanylethyl]benzamide |
|---|---|
| PubChem CID | 142554376 |
| Molecular Formula | C33H34ClNO7S2 |
| Molecular Weight | 656.22 g/mol |
| Exact Mass | 655.15 |
| IUPAC Name | 2-chloro-3,4-bis[(4-methoxyphenyl)methoxy]-N-methyl-N-[2-(4-methylphenyl)sulfonylsulfanylethyl]benzamide |
| SMILES | COc1ccc(COc2ccc(C(=O)N(C)CCSS(=O)(=O)c3ccc(C)cc3)c(Cl)c2OCc2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C33H34ClNO7S2/c1-23-5-15-28(16-6-23)44(37,38)43-20-19-35(2)33(36)29-17-18-30(41-21-24-7-11-26(39-3)12-8-24)32(31(29)34)42-22-25-9-13-27(40-4)14-10-25/h5-18H,19-22H2,1-4H3 |
| InChIKey | GRDGNXKHILOQFL-UHFFFAOYSA-N |
| XLogP | 7.02 |
| TPSA | 91.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 656.22 |
| LogP ≤ 5 | 7.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|