C30H36ClN5O7 — CID 139577017
tert-butyl N-[2-chloro-3,4-bis[(4-methoxyphenyl)methoxy]benzoyl]-N-[(2Z)-2-hydrazinyl-2-hydrazinylideneethyl]carbamate (PubChem CID 139577017) has the molecular formula C30H36ClN5O7 and a molecular weight of 614.10 g/mol. Its IUPAC name is tert-butyl N-[2-chloro-3,4-bis[(4-methoxyphenyl)methoxy]benzoyl]-N-[(2Z)-2-hydrazinyl-2-hydrazinylideneethyl]carbamate.
| Compound Name | tert-butyl N-[2-chloro-3,4-bis[(4-methoxyphenyl)methoxy]benzoyl]-N-[(2Z)-2-hydrazinyl-2-hydrazinylideneethyl]carbamate |
|---|---|
| PubChem CID | 139577017 |
| Molecular Formula | C30H36ClN5O7 |
| Molecular Weight | 614.10 g/mol |
| Exact Mass | 613.23 |
| IUPAC Name | tert-butyl N-[2-chloro-3,4-bis[(4-methoxyphenyl)methoxy]benzoyl]-N-[(2Z)-2-hydrazinyl-2-hydrazinylideneethyl]carbamate |
| SMILES | COc1ccc(COc2ccc(C(=O)N(C/C(=N/N)NN)C(=O)OC(C)(C)C)c(Cl)c2OCc2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C30H36ClN5O7/c1-30(2,3)43-29(38)36(16-25(34-32)35-33)28(37)23-14-15-24(41-17-19-6-10-21(39-4)11-7-19)27(26(23)31)42-18-20-8-12-22(40-5)13-9-20/h6-15H,16-18,32-33H2,1-5H3,(H,34,35) |
| InChIKey | SKHRIUYDASACHP-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 159.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 614.10 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|