C38H43ClN2O9S2 — CID 142554320
tert-butyl N-[2-chloro-3,4-bis[(4-methoxyphenyl)methoxy]benzoyl]-N-[methyl-[2-(4-methylphenyl)sulfonylsulfanylethyl]amino]carbamate (PubChem CID 142554320) has the molecular formula C38H43ClN2O9S2 and a molecular weight of 771.35 g/mol. Its IUPAC name is tert-butyl N-[2-chloro-3,4-bis[(4-methoxyphenyl)methoxy]benzoyl]-N-[methyl-[2-(4-methylphenyl)sulfonylsulfanylethyl]amino]carbamate.
| Compound Name | tert-butyl N-[2-chloro-3,4-bis[(4-methoxyphenyl)methoxy]benzoyl]-N-[methyl-[2-(4-methylphenyl)sulfonylsulfanylethyl]amino]carbamate |
|---|---|
| PubChem CID | 142554320 |
| Molecular Formula | C38H43ClN2O9S2 |
| Molecular Weight | 771.35 g/mol |
| Exact Mass | 770.21 |
| IUPAC Name | tert-butyl N-[2-chloro-3,4-bis[(4-methoxyphenyl)methoxy]benzoyl]-N-[methyl-[2-(4-methylphenyl)sulfonylsulfanylethyl]amino]carbamate |
| SMILES | COc1ccc(COc2ccc(C(=O)N(C(=O)OC(C)(C)C)N(C)CCSS(=O)(=O)c3ccc(C)cc3)c(Cl)c2OCc2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C38H43ClN2O9S2/c1-26-8-18-31(19-9-26)52(44,45)51-23-22-40(5)41(37(43)50-38(2,3)4)36(42)32-20-21-33(48-24-27-10-14-29(46-6)15-11-27)35(34(32)39)49-25-28-12-16-30(47-7)17-13-28/h8-21H,22-25H2,1-7H3 |
| InChIKey | YCEXAQMRAITURE-UHFFFAOYSA-N |
| XLogP | 8.17 |
| TPSA | 120.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 52 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 771.35 |
| LogP ≤ 5 | 8.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|