C28H31ClN2O5 — CID 157141760
2-[2-chloro-3,4-bis[(4-methoxyphenyl)methoxy]phenyl]-2-methylimino-N-propylacetamide (PubChem CID 157141760) has the molecular formula C28H31ClN2O5 and a molecular weight of 511.02 g/mol. Its IUPAC name is 2-[2-chloro-3,4-bis[(4-methoxyphenyl)methoxy]phenyl]-2-methylimino-N-propylacetamide.
| Compound Name | 2-[2-chloro-3,4-bis[(4-methoxyphenyl)methoxy]phenyl]-2-methylimino-N-propylacetamide |
|---|---|
| PubChem CID | 157141760 |
| Molecular Formula | C28H31ClN2O5 |
| Molecular Weight | 511.02 g/mol |
| Exact Mass | 510.19 |
| IUPAC Name | 2-[2-chloro-3,4-bis[(4-methoxyphenyl)methoxy]phenyl]-2-methylimino-N-propylacetamide |
| SMILES | CCCNC(=O)/C(=N\C)c1ccc(OCc2ccc(OC)cc2)c(OCc2ccc(OC)cc2)c1Cl |
| InChI | InChI=1S/C28H31ClN2O5/c1-5-16-31-28(32)26(30-2)23-14-15-24(35-17-19-6-10-21(33-3)11-7-19)27(25(23)29)36-18-20-8-12-22(34-4)13-9-20/h6-15H,5,16-18H2,1-4H3,(H,31,32)/b30-26- |
| InChIKey | IJLGXLZNZVAESV-BXVZCJGGSA-N |
| XLogP | 5.46 |
| TPSA | 78.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.02 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|