C28H28ClNO9 — CID 155773364
(2S)-2-[[2-[2-chloro-3,4-bis[(4-methoxyphenyl)methoxy]phenyl]-2-oxoacetyl]amino]-3-(deuteriomethoxy)propanoic acid (PubChem CID 155773364) has the molecular formula C28H28ClNO9 and a molecular weight of 558.99 g/mol. Its IUPAC name is (2S)-2-[[2-[2-chloro-3,4-bis[(4-methoxyphenyl)methoxy]phenyl]-2-oxoacetyl]amino]-3-(deuteriomethoxy)propanoic acid.
| Compound Name | (2S)-2-[[2-[2-chloro-3,4-bis[(4-methoxyphenyl)methoxy]phenyl]-2-oxoacetyl]amino]-3-(deuteriomethoxy)propanoic acid |
|---|---|
| PubChem CID | 155773364 |
| Molecular Formula | C28H28ClNO9 |
| Molecular Weight | 558.99 g/mol |
| Exact Mass | 558.15 |
| IUPAC Name | (2S)-2-[[2-[2-chloro-3,4-bis[(4-methoxyphenyl)methoxy]phenyl]-2-oxoacetyl]amino]-3-(deuteriomethoxy)propanoic acid |
| SMILES | [2H]COC[C@H](NC(=O)C(=O)c1ccc(OCc2ccc(OC)cc2)c(OCc2ccc(OC)cc2)c1Cl)C(=O)O |
| InChI | InChI=1S/C28H28ClNO9/c1-35-16-22(28(33)34)30-27(32)25(31)21-12-13-23(38-14-17-4-8-19(36-2)9-5-17)26(24(21)29)39-15-18-6-10-20(37-3)11-7-18/h4-13,22H,14-16H2,1-3H3,(H,30,32)(H,33,34)/t22-/m0/s1/i1D |
| InChIKey | DEBORABGRUEEPJ-YWVAFJLOSA-N |
| XLogP | 3.91 |
| TPSA | 129.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.99 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|