C23H20ClNO5 — CID 58373949
2-chloro-1-isocyanato-3,4-bis[(4-methoxyphenyl)methoxy]benzene (PubChem CID 58373949) has the molecular formula C23H20ClNO5 and a molecular weight of 425.87 g/mol. Its IUPAC name is 2-chloro-1-isocyanato-3,4-bis[(4-methoxyphenyl)methoxy]benzene.
| Compound Name | 2-chloro-1-isocyanato-3,4-bis[(4-methoxyphenyl)methoxy]benzene |
|---|---|
| PubChem CID | 58373949 |
| Molecular Formula | C23H20ClNO5 |
| Molecular Weight | 425.87 g/mol |
| Exact Mass | 425.10 |
| IUPAC Name | 2-chloro-1-isocyanato-3,4-bis[(4-methoxyphenyl)methoxy]benzene |
| SMILES | COc1ccc(COc2ccc(N=C=O)c(Cl)c2OCc2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C23H20ClNO5/c1-27-18-7-3-16(4-8-18)13-29-21-12-11-20(25-15-26)22(24)23(21)30-14-17-5-9-19(28-2)10-6-17/h3-12H,13-14H2,1-2H3 |
| InChIKey | HTRHERMJSISKGU-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 66.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.87 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|