C42H48ClN3O10S2 — CID 142554313
tert-butyl N-[(2Z)-2-[2-chloro-3,4-bis[(4-methoxyphenyl)methoxy]phenyl]-2-morpholin-4-yliminoacetyl]-N-[2-(4-methylphenyl)sulfonylsulfanylethyl]carbamate (PubChem CID 142554313) has the molecular formula C42H48ClN3O10S2 and a molecular weight of 854.44 g/mol. Its IUPAC name is tert-butyl N-[(2Z)-2-[2-chloro-3,4-bis[(4-methoxyphenyl)methoxy]phenyl]-2-morpholin-4-yliminoacetyl]-N-[2-(4-methylphenyl)sulfonylsulfanylethyl]carbamate.
| Compound Name | tert-butyl N-[(2Z)-2-[2-chloro-3,4-bis[(4-methoxyphenyl)methoxy]phenyl]-2-morpholin-4-yliminoacetyl]-N-[2-(4-methylphenyl)sulfonylsulfanylethyl]carbamate |
|---|---|
| PubChem CID | 142554313 |
| Molecular Formula | C42H48ClN3O10S2 |
| Molecular Weight | 854.44 g/mol |
| Exact Mass | 853.25 |
| IUPAC Name | tert-butyl N-[(2Z)-2-[2-chloro-3,4-bis[(4-methoxyphenyl)methoxy]phenyl]-2-morpholin-4-yliminoacetyl]-N-[2-(4-methylphenyl)sulfonylsulfanylethyl]carbamate |
| SMILES | COc1ccc(COc2ccc(/C(=N/N3CCOCC3)C(=O)N(CCSS(=O)(=O)c3ccc(C)cc3)C(=O)OC(C)(C)C)c(Cl)c2OCc2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C42H48ClN3O10S2/c1-29-7-17-34(18-8-29)58(49,50)57-26-23-46(41(48)56-42(2,3)4)40(47)38(44-45-21-24-53-25-22-45)35-19-20-36(54-27-30-9-13-32(51-5)14-10-30)39(37(35)43)55-28-31-11-15-33(52-6)16-12-31/h7-20H,21-28H2,1-6H3/b44-38- |
| InChIKey | SFJLDORTAFUJMJ-XUMWXMTGSA-N |
| XLogP | 7.75 |
| TPSA | 142.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 58 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 854.44 |
| LogP ≤ 5 | 7.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|