C28H29BrClNO6 — CID 154612315
[(3S)-3-(bromomethyl)morpholin-4-yl]-[2-chloro-3,4-bis[(4-methoxyphenyl)methoxy]phenyl]methanone (PubChem CID 154612315) has the molecular formula C28H29BrClNO6 and a molecular weight of 590.90 g/mol. Its IUPAC name is [(3S)-3-(bromomethyl)morpholin-4-yl]-[2-chloro-3,4-bis[(4-methoxyphenyl)methoxy]phenyl]methanone.
| Compound Name | [(3S)-3-(bromomethyl)morpholin-4-yl]-[2-chloro-3,4-bis[(4-methoxyphenyl)methoxy]phenyl]methanone |
|---|---|
| PubChem CID | 154612315 |
| Molecular Formula | C28H29BrClNO6 |
| Molecular Weight | 590.90 g/mol |
| Exact Mass | 589.09 |
| IUPAC Name | [(3S)-3-(bromomethyl)morpholin-4-yl]-[2-chloro-3,4-bis[(4-methoxyphenyl)methoxy]phenyl]methanone |
| SMILES | COc1ccc(COc2ccc(C(=O)N3CCOC[C@H]3CBr)c(Cl)c2OCc2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C28H29BrClNO6/c1-33-22-7-3-19(4-8-22)16-36-25-12-11-24(28(32)31-13-14-35-18-21(31)15-29)26(30)27(25)37-17-20-5-9-23(34-2)10-6-20/h3-12,21H,13-18H2,1-2H3/t21-/m1/s1 |
| InChIKey | SVZFICOQBDNXQW-OAQYLSRUSA-N |
| XLogP | 5.75 |
| TPSA | 66.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.90 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|