C43H38O6 — CID 10886822
tert-butyl 3,5-bis(phenylmethoxy)-4-(2-phenylmethoxynaphthalene-1-carbonyl)benzoate (PubChem CID 10886822) has the molecular formula C43H38O6 and a molecular weight of 650.77 g/mol. Its IUPAC name is tert-butyl 3,5-bis(phenylmethoxy)-4-(2-phenylmethoxynaphthalene-1-carbonyl)benzoate.
| Compound Name | tert-butyl 3,5-bis(phenylmethoxy)-4-(2-phenylmethoxynaphthalene-1-carbonyl)benzoate |
|---|---|
| PubChem CID | 10886822 |
| Molecular Formula | C43H38O6 |
| Molecular Weight | 650.77 g/mol |
| Exact Mass | 650.27 |
| IUPAC Name | tert-butyl 3,5-bis(phenylmethoxy)-4-(2-phenylmethoxynaphthalene-1-carbonyl)benzoate |
| SMILES | CC(C)(C)OC(=O)c1cc(OCc2ccccc2)c(C(=O)c2c(OCc3ccccc3)ccc3ccccc23)c(OCc2ccccc2)c1 |
| InChI | InChI=1S/C43H38O6/c1-43(2,3)49-42(45)34-25-37(47-28-31-17-9-5-10-18-31)40(38(26-34)48-29-32-19-11-6-12-20-32)41(44)39-35-22-14-13-21-33(35)23-24-36(39)46-27-30-15-7-4-8-16-30/h4-26H,27-29H2,1-3H3 |
| InChIKey | UASFKOGNSBBDGL-UHFFFAOYSA-N |
| XLogP | 9.76 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 650.77 |
| LogP ≤ 5 | 9.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |