C21H24N2O4 — CID 66970244
3-methoxy-2-[2-[(6-pyrrolidin-1-yl-2-pyridinyl)oxymethyl]phenyl]but-2-enoic acid (PubChem CID 66970244) has the molecular formula C21H24N2O4 and a molecular weight of 368.43 g/mol. Its IUPAC name is 3-methoxy-2-[2-[(6-pyrrolidin-1-yl-2-pyridinyl)oxymethyl]phenyl]but-2-enoic acid.
| Compound Name | 3-methoxy-2-[2-[(6-pyrrolidin-1-yl-2-pyridinyl)oxymethyl]phenyl]but-2-enoic acid |
|---|---|
| PubChem CID | 66970244 |
| Molecular Formula | C21H24N2O4 |
| Molecular Weight | 368.43 g/mol |
| Exact Mass | 368.17 |
| IUPAC Name | 3-methoxy-2-[2-[(6-pyrrolidin-1-yl-2-pyridinyl)oxymethyl]phenyl]but-2-enoic acid |
| SMILES | COC(C)=C(C(=O)O)c1ccccc1COc1cccc(N2CCCC2)n1 |
| InChI | InChI=1S/C21H24N2O4/c1-15(26-2)20(21(24)25)17-9-4-3-8-16(17)14-27-19-11-7-10-18(22-19)23-12-5-6-13-23/h3-4,7-11H,5-6,12-14H2,1-2H3,(H,24,25) |
| InChIKey | IOYSUVSLWKUKOW-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 71.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.43 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|