C20H20Cl2N2O4 — CID 141180663
(E)-2-[2-[[[C-(3,4-dichlorophenyl)-N-methylcarbonimidoyl]amino]oxymethyl]phenyl]-3-methoxybut-2-enoic acid (PubChem CID 141180663) has the molecular formula C20H20Cl2N2O4 and a molecular weight of 423.30 g/mol. Its IUPAC name is (E)-2-[2-[[[C-(3,4-dichlorophenyl)-N-methylcarbonimidoyl]amino]oxymethyl]phenyl]-3-methoxybut-2-enoic acid.
| Compound Name | (E)-2-[2-[[[C-(3,4-dichlorophenyl)-N-methylcarbonimidoyl]amino]oxymethyl]phenyl]-3-methoxybut-2-enoic acid |
|---|---|
| PubChem CID | 141180663 |
| Molecular Formula | C20H20Cl2N2O4 |
| Molecular Weight | 423.30 g/mol |
| Exact Mass | 422.08 |
| IUPAC Name | (E)-2-[2-[[[C-(3,4-dichlorophenyl)-N-methylcarbonimidoyl]amino]oxymethyl]phenyl]-3-methoxybut-2-enoic acid |
| SMILES | C/N=C(\NOCc1ccccc1/C(C(=O)O)=C(/C)OC)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C20H20Cl2N2O4/c1-12(27-3)18(20(25)26)15-7-5-4-6-14(15)11-28-24-19(23-2)13-8-9-16(21)17(22)10-13/h4-10H,11H2,1-3H3,(H,23,24)(H,25,26)/b18-12+ |
| InChIKey | TZWFBKKLWUHKLK-LDADJPATSA-N |
| XLogP | 4.55 |
| TPSA | 80.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.30 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|