C23H28FNO4 — CID 66970120
2-[2-[[2-fluoro-4-[methyl(2-methylpropyl)amino]phenoxy]methyl]phenyl]-3-methoxybut-2-enoic acid (PubChem CID 66970120) has the molecular formula C23H28FNO4 and a molecular weight of 401.48 g/mol. Its IUPAC name is 2-[2-[[2-fluoro-4-[methyl(2-methylpropyl)amino]phenoxy]methyl]phenyl]-3-methoxybut-2-enoic acid.
| Compound Name | 2-[2-[[2-fluoro-4-[methyl(2-methylpropyl)amino]phenoxy]methyl]phenyl]-3-methoxybut-2-enoic acid |
|---|---|
| PubChem CID | 66970120 |
| Molecular Formula | C23H28FNO4 |
| Molecular Weight | 401.48 g/mol |
| Exact Mass | 401.20 |
| IUPAC Name | 2-[2-[[2-fluoro-4-[methyl(2-methylpropyl)amino]phenoxy]methyl]phenyl]-3-methoxybut-2-enoic acid |
| SMILES | COC(C)=C(C(=O)O)c1ccccc1COc1ccc(N(C)CC(C)C)cc1F |
| InChI | InChI=1S/C23H28FNO4/c1-15(2)13-25(4)18-10-11-21(20(24)12-18)29-14-17-8-6-7-9-19(17)22(23(26)27)16(3)28-5/h6-12,15H,13-14H2,1-5H3,(H,26,27) |
| InChIKey | LYPQHPAYCWYCGI-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.48 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|