C16H14ClFO4 — CID 122645579
[2-[(5-chloro-2-fluoro-4-methylphenoxy)methyl]phenyl] methyl carbonate (PubChem CID 122645579) has the molecular formula C16H14ClFO4 and a molecular weight of 324.74 g/mol. Its IUPAC name is [2-[(5-chloro-2-fluoro-4-methylphenoxy)methyl]phenyl] methyl carbonate.
| Compound Name | [2-[(5-chloro-2-fluoro-4-methylphenoxy)methyl]phenyl] methyl carbonate |
|---|---|
| PubChem CID | 122645579 |
| Molecular Formula | C16H14ClFO4 |
| Molecular Weight | 324.74 g/mol |
| Exact Mass | 324.06 |
| IUPAC Name | [2-[(5-chloro-2-fluoro-4-methylphenoxy)methyl]phenyl] methyl carbonate |
| SMILES | COC(=O)Oc1ccccc1COc1cc(Cl)c(C)cc1F |
| InChI | InChI=1S/C16H14ClFO4/c1-10-7-13(18)15(8-12(10)17)21-9-11-5-3-4-6-14(11)22-16(19)20-2/h3-8H,9H2,1-2H3 |
| InChIKey | BEWIBJHXAQAIDS-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.74 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|