C19H21FO5 — CID 122645685
[3-ethoxy-2-[(2-fluoro-4,5-dimethylphenoxy)methyl]phenyl] methyl carbonate (PubChem CID 122645685) has the molecular formula C19H21FO5 and a molecular weight of 348.37 g/mol. Its IUPAC name is [3-ethoxy-2-[(2-fluoro-4,5-dimethylphenoxy)methyl]phenyl] methyl carbonate.
| Compound Name | [3-ethoxy-2-[(2-fluoro-4,5-dimethylphenoxy)methyl]phenyl] methyl carbonate |
|---|---|
| PubChem CID | 122645685 |
| Molecular Formula | C19H21FO5 |
| Molecular Weight | 348.37 g/mol |
| Exact Mass | 348.14 |
| IUPAC Name | [3-ethoxy-2-[(2-fluoro-4,5-dimethylphenoxy)methyl]phenyl] methyl carbonate |
| SMILES | CCOc1cccc(OC(=O)OC)c1COc1cc(C)c(C)cc1F |
| InChI | InChI=1S/C19H21FO5/c1-5-23-16-7-6-8-17(25-19(21)22-4)14(16)11-24-18-10-13(3)12(2)9-15(18)20/h6-10H,5,11H2,1-4H3 |
| InChIKey | FQDQESHVBSWCCK-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.37 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|