C20H24FNO4 — CID 126587722
methyl N-[3-ethoxy-2-[(4-ethyl-2-fluoro-5-methylphenoxy)methyl]phenyl]carbamate (PubChem CID 126587722) has the molecular formula C20H24FNO4 and a molecular weight of 361.41 g/mol. Its IUPAC name is methyl N-[3-ethoxy-2-[(4-ethyl-2-fluoro-5-methylphenoxy)methyl]phenyl]carbamate.
| Compound Name | methyl N-[3-ethoxy-2-[(4-ethyl-2-fluoro-5-methylphenoxy)methyl]phenyl]carbamate |
|---|---|
| PubChem CID | 126587722 |
| Molecular Formula | C20H24FNO4 |
| Molecular Weight | 361.41 g/mol |
| Exact Mass | 361.17 |
| IUPAC Name | methyl N-[3-ethoxy-2-[(4-ethyl-2-fluoro-5-methylphenoxy)methyl]phenyl]carbamate |
| SMILES | CCOc1cccc(NC(=O)OC)c1COc1cc(C)c(CC)cc1F |
| InChI | InChI=1S/C20H24FNO4/c1-5-14-11-16(21)19(10-13(14)3)26-12-15-17(22-20(23)24-4)8-7-9-18(15)25-6-2/h7-11H,5-6,12H2,1-4H3,(H,22,23) |
| InChIKey | JCLVCNNVXJHOQM-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.41 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |