C20H25NO3S — CID 129038535
O-methyl N-[3-ethoxy-2-[(2,4,5-trimethylphenoxy)methyl]phenyl]carbamothioate (PubChem CID 129038535) has the molecular formula C20H25NO3S and a molecular weight of 359.49 g/mol. Its IUPAC name is O-methyl N-[3-ethoxy-2-[(2,4,5-trimethylphenoxy)methyl]phenyl]carbamothioate.
| Compound Name | O-methyl N-[3-ethoxy-2-[(2,4,5-trimethylphenoxy)methyl]phenyl]carbamothioate |
|---|---|
| PubChem CID | 129038535 |
| Molecular Formula | C20H25NO3S |
| Molecular Weight | 359.49 g/mol |
| Exact Mass | 359.16 |
| IUPAC Name | O-methyl N-[3-ethoxy-2-[(2,4,5-trimethylphenoxy)methyl]phenyl]carbamothioate |
| SMILES | CCOc1cccc(NC(=S)OC)c1COc1cc(C)c(C)cc1C |
| InChI | InChI=1S/C20H25NO3S/c1-6-23-18-9-7-8-17(21-20(25)22-5)16(18)12-24-19-11-14(3)13(2)10-15(19)4/h7-11H,6,12H2,1-5H3,(H,21,25) |
| InChIKey | CWBUQQVOLXFKKE-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 39.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.49 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|