C18H19FINO2S — CID 129038580
O-(fluoromethyl) N-[3-iodo-2-[(2,4,5-trimethylphenoxy)methyl]phenyl]carbamothioate (PubChem CID 129038580) has the molecular formula C18H19FINO2S and a molecular weight of 459.32 g/mol. Its IUPAC name is O-(fluoromethyl) N-[3-iodo-2-[(2,4,5-trimethylphenoxy)methyl]phenyl]carbamothioate.
| Compound Name | O-(fluoromethyl) N-[3-iodo-2-[(2,4,5-trimethylphenoxy)methyl]phenyl]carbamothioate |
|---|---|
| PubChem CID | 129038580 |
| Molecular Formula | C18H19FINO2S |
| Molecular Weight | 459.32 g/mol |
| Exact Mass | 459.02 |
| IUPAC Name | O-(fluoromethyl) N-[3-iodo-2-[(2,4,5-trimethylphenoxy)methyl]phenyl]carbamothioate |
| SMILES | Cc1cc(C)c(OCc2c(I)cccc2NC(=S)OCF)cc1C |
| InChI | InChI=1S/C18H19FINO2S/c1-11-7-13(3)17(8-12(11)2)22-9-14-15(20)5-4-6-16(14)21-18(24)23-10-19/h4-8H,9-10H2,1-3H3,(H,21,24) |
| InChIKey | YQABJWOMWKWUKG-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.32 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|