C18H19FINO3 — CID 126589277
fluoromethyl N-[2-[(4-ethyl-2-methylphenoxy)methyl]-3-iodophenyl]carbamate (PubChem CID 126589277) has the molecular formula C18H19FINO3 and a molecular weight of 443.26 g/mol. Its IUPAC name is fluoromethyl N-[2-[(4-ethyl-2-methylphenoxy)methyl]-3-iodophenyl]carbamate.
| Compound Name | fluoromethyl N-[2-[(4-ethyl-2-methylphenoxy)methyl]-3-iodophenyl]carbamate |
|---|---|
| PubChem CID | 126589277 |
| Molecular Formula | C18H19FINO3 |
| Molecular Weight | 443.26 g/mol |
| Exact Mass | 443.04 |
| IUPAC Name | fluoromethyl N-[2-[(4-ethyl-2-methylphenoxy)methyl]-3-iodophenyl]carbamate |
| SMILES | CCc1ccc(OCc2c(I)cccc2NC(=O)OCF)c(C)c1 |
| InChI | InChI=1S/C18H19FINO3/c1-3-13-7-8-17(12(2)9-13)23-10-14-15(20)5-4-6-16(14)21-18(22)24-11-19/h4-9H,3,10-11H2,1-2H3,(H,21,22) |
| InChIKey | BCPHMLHUJXMZEL-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.26 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|