C17H17FINO3 — CID 126588359
methyl N-[2-[(4-ethyl-2-fluorophenoxy)methyl]-3-iodophenyl]carbamate (PubChem CID 126588359) has the molecular formula C17H17FINO3 and a molecular weight of 429.23 g/mol. Its IUPAC name is methyl N-[2-[(4-ethyl-2-fluorophenoxy)methyl]-3-iodophenyl]carbamate.
| Compound Name | methyl N-[2-[(4-ethyl-2-fluorophenoxy)methyl]-3-iodophenyl]carbamate |
|---|---|
| PubChem CID | 126588359 |
| Molecular Formula | C17H17FINO3 |
| Molecular Weight | 429.23 g/mol |
| Exact Mass | 429.02 |
| IUPAC Name | methyl N-[2-[(4-ethyl-2-fluorophenoxy)methyl]-3-iodophenyl]carbamate |
| SMILES | CCc1ccc(OCc2c(I)cccc2NC(=O)OC)c(F)c1 |
| InChI | InChI=1S/C17H17FINO3/c1-3-11-7-8-16(13(18)9-11)23-10-12-14(19)5-4-6-15(12)20-17(21)22-2/h4-9H,3,10H2,1-2H3,(H,20,21) |
| InChIKey | APYNXYJOAJTGEX-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.23 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|