C18H20INO3 — CID 129038436
methyl N-[3-iodo-2-[(2,4,5-trimethylphenoxy)methyl]phenyl]carbamate (PubChem CID 129038436) has the molecular formula C18H20INO3 and a molecular weight of 425.27 g/mol. Its IUPAC name is methyl N-[3-iodo-2-[(2,4,5-trimethylphenoxy)methyl]phenyl]carbamate.
| Compound Name | methyl N-[3-iodo-2-[(2,4,5-trimethylphenoxy)methyl]phenyl]carbamate |
|---|---|
| PubChem CID | 129038436 |
| Molecular Formula | C18H20INO3 |
| Molecular Weight | 425.27 g/mol |
| Exact Mass | 425.05 |
| IUPAC Name | methyl N-[3-iodo-2-[(2,4,5-trimethylphenoxy)methyl]phenyl]carbamate |
| SMILES | COC(=O)Nc1cccc(I)c1COc1cc(C)c(C)cc1C |
| InChI | InChI=1S/C18H20INO3/c1-11-8-13(3)17(9-12(11)2)23-10-14-15(19)6-5-7-16(14)20-18(21)22-4/h5-9H,10H2,1-4H3,(H,20,21) |
| InChIKey | LYPLWXOOVSQWAW-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.27 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|