C18H20INO2S — CID 129038441
O-methyl N-[3-iodo-2-[(2,4,5-trimethylphenoxy)methyl]phenyl]carbamothioate (PubChem CID 129038441) has the molecular formula C18H20INO2S and a molecular weight of 441.33 g/mol. Its IUPAC name is O-methyl N-[3-iodo-2-[(2,4,5-trimethylphenoxy)methyl]phenyl]carbamothioate.
| Compound Name | O-methyl N-[3-iodo-2-[(2,4,5-trimethylphenoxy)methyl]phenyl]carbamothioate |
|---|---|
| PubChem CID | 129038441 |
| Molecular Formula | C18H20INO2S |
| Molecular Weight | 441.33 g/mol |
| Exact Mass | 441.03 |
| IUPAC Name | O-methyl N-[3-iodo-2-[(2,4,5-trimethylphenoxy)methyl]phenyl]carbamothioate |
| SMILES | COC(=S)Nc1cccc(I)c1COc1cc(C)c(C)cc1C |
| InChI | InChI=1S/C18H20INO2S/c1-11-8-13(3)17(9-12(11)2)22-10-14-15(19)6-5-7-16(14)20-18(23)21-4/h5-9H,10H2,1-4H3,(H,20,23) |
| InChIKey | LWMZOCLGOAZLEO-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.33 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|