C19H22INO2S — CID 126588855
S-methyl N-[2-[(4-ethyl-2,5-dimethylphenoxy)methyl]-3-iodophenyl]carbamothioate (PubChem CID 126588855) has the molecular formula C19H22INO2S and a molecular weight of 455.36 g/mol. Its IUPAC name is S-methyl N-[2-[(4-ethyl-2,5-dimethylphenoxy)methyl]-3-iodophenyl]carbamothioate.
| Compound Name | S-methyl N-[2-[(4-ethyl-2,5-dimethylphenoxy)methyl]-3-iodophenyl]carbamothioate |
|---|---|
| PubChem CID | 126588855 |
| Molecular Formula | C19H22INO2S |
| Molecular Weight | 455.36 g/mol |
| Exact Mass | 455.04 |
| IUPAC Name | S-methyl N-[2-[(4-ethyl-2,5-dimethylphenoxy)methyl]-3-iodophenyl]carbamothioate |
| SMILES | CCc1cc(C)c(OCc2c(I)cccc2NC(=O)SC)cc1C |
| InChI | InChI=1S/C19H22INO2S/c1-5-14-9-13(3)18(10-12(14)2)23-11-15-16(20)7-6-8-17(15)21-19(22)24-4/h6-10H,5,11H2,1-4H3,(H,21,22) |
| InChIKey | DMJXNQLJGVTUDO-UHFFFAOYSA-N |
| XLogP | 5.94 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.36 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|