C18H19ClFNO2S — CID 129054223
S-methyl N-[3-chloro-2-[(4-ethyl-2-fluoro-5-methylphenoxy)methyl]phenyl]carbamothioate (PubChem CID 129054223) has the molecular formula C18H19ClFNO2S and a molecular weight of 367.87 g/mol. Its IUPAC name is S-methyl N-[3-chloro-2-[(4-ethyl-2-fluoro-5-methylphenoxy)methyl]phenyl]carbamothioate.
| Compound Name | S-methyl N-[3-chloro-2-[(4-ethyl-2-fluoro-5-methylphenoxy)methyl]phenyl]carbamothioate |
|---|---|
| PubChem CID | 129054223 |
| Molecular Formula | C18H19ClFNO2S |
| Molecular Weight | 367.87 g/mol |
| Exact Mass | 367.08 |
| IUPAC Name | S-methyl N-[3-chloro-2-[(4-ethyl-2-fluoro-5-methylphenoxy)methyl]phenyl]carbamothioate |
| SMILES | CCc1cc(F)c(OCc2c(Cl)cccc2NC(=O)SC)cc1C |
| InChI | InChI=1S/C18H19ClFNO2S/c1-4-12-9-15(20)17(8-11(12)2)23-10-13-14(19)6-5-7-16(13)21-18(22)24-3/h5-9H,4,10H2,1-3H3,(H,21,22) |
| InChIKey | JKOLERNZANPFNV-UHFFFAOYSA-N |
| XLogP | 5.82 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.87 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|