C19H19F3INO2S — CID 126587747
O-methyl N-[2-[[4-ethyl-5-methyl-2-(trifluoromethyl)phenoxy]methyl]-3-iodophenyl]carbamothioate (PubChem CID 126587747) has the molecular formula C19H19F3INO2S and a molecular weight of 509.33 g/mol. Its IUPAC name is O-methyl N-[2-[[4-ethyl-5-methyl-2-(trifluoromethyl)phenoxy]methyl]-3-iodophenyl]carbamothioate.
| Compound Name | O-methyl N-[2-[[4-ethyl-5-methyl-2-(trifluoromethyl)phenoxy]methyl]-3-iodophenyl]carbamothioate |
|---|---|
| PubChem CID | 126587747 |
| Molecular Formula | C19H19F3INO2S |
| Molecular Weight | 509.33 g/mol |
| Exact Mass | 509.01 |
| IUPAC Name | O-methyl N-[2-[[4-ethyl-5-methyl-2-(trifluoromethyl)phenoxy]methyl]-3-iodophenyl]carbamothioate |
| SMILES | CCc1cc(C(F)(F)F)c(OCc2c(I)cccc2NC(=S)OC)cc1C |
| InChI | InChI=1S/C19H19F3INO2S/c1-4-12-9-14(19(20,21)22)17(8-11(12)2)26-10-13-15(23)6-5-7-16(13)24-18(27)25-3/h5-9H,4,10H2,1-3H3,(H,24,27) |
| InChIKey | RZNATJUVBMPXPB-UHFFFAOYSA-N |
| XLogP | 6.10 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.33 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|