C21H24F3NO2S — CID 126588415
O-ethyl N-[2-[(4-ethyl-2,5-dimethylphenoxy)methyl]-3-(trifluoromethyl)phenyl]carbamothioate (PubChem CID 126588415) has the molecular formula C21H24F3NO2S and a molecular weight of 411.49 g/mol. Its IUPAC name is O-ethyl N-[2-[(4-ethyl-2,5-dimethylphenoxy)methyl]-3-(trifluoromethyl)phenyl]carbamothioate.
| Compound Name | O-ethyl N-[2-[(4-ethyl-2,5-dimethylphenoxy)methyl]-3-(trifluoromethyl)phenyl]carbamothioate |
|---|---|
| PubChem CID | 126588415 |
| Molecular Formula | C21H24F3NO2S |
| Molecular Weight | 411.49 g/mol |
| Exact Mass | 411.15 |
| IUPAC Name | O-ethyl N-[2-[(4-ethyl-2,5-dimethylphenoxy)methyl]-3-(trifluoromethyl)phenyl]carbamothioate |
| SMILES | CCOC(=S)Nc1cccc(C(F)(F)F)c1COc1cc(C)c(CC)cc1C |
| InChI | InChI=1S/C21H24F3NO2S/c1-5-15-10-14(4)19(11-13(15)3)27-12-16-17(21(22,23)24)8-7-9-18(16)25-20(28)26-6-2/h7-11H,5-6,12H2,1-4H3,(H,25,28) |
| InChIKey | YPKLVKHNPDHKKM-UHFFFAOYSA-N |
| XLogP | 6.20 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.49 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|