C21H25F2NOS — CID 126588986
N-[3-(difluoromethyl)-2-[(4-ethyl-2,5-dimethylphenoxy)methyl]phenyl]propanethioamide (PubChem CID 126588986) has the molecular formula C21H25F2NOS and a molecular weight of 377.50 g/mol. Its IUPAC name is N-[3-(difluoromethyl)-2-[(4-ethyl-2,5-dimethylphenoxy)methyl]phenyl]propanethioamide.
| Compound Name | N-[3-(difluoromethyl)-2-[(4-ethyl-2,5-dimethylphenoxy)methyl]phenyl]propanethioamide |
|---|---|
| PubChem CID | 126588986 |
| Molecular Formula | C21H25F2NOS |
| Molecular Weight | 377.50 g/mol |
| Exact Mass | 377.16 |
| IUPAC Name | N-[3-(difluoromethyl)-2-[(4-ethyl-2,5-dimethylphenoxy)methyl]phenyl]propanethioamide |
| SMILES | CCC(=S)Nc1cccc(C(F)F)c1COc1cc(C)c(CC)cc1C |
| InChI | InChI=1S/C21H25F2NOS/c1-5-15-10-14(4)19(11-13(15)3)25-12-17-16(21(22)23)8-7-9-18(17)24-20(26)6-2/h7-11,21H,5-6,12H2,1-4H3,(H,24,26) |
| InChIKey | LQVNRKMYHBKTOB-UHFFFAOYSA-N |
| XLogP | 6.53 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.50 |
| LogP ≤ 5 | 6.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|