C20H25NOS — CID 126588966
N-[2-[(4-ethyl-2,5-dimethylphenoxy)methyl]phenyl]propanethioamide (PubChem CID 126588966) has the molecular formula C20H25NOS and a molecular weight of 327.49 g/mol. Its IUPAC name is N-[2-[(4-ethyl-2,5-dimethylphenoxy)methyl]phenyl]propanethioamide.
| Compound Name | N-[2-[(4-ethyl-2,5-dimethylphenoxy)methyl]phenyl]propanethioamide |
|---|---|
| PubChem CID | 126588966 |
| Molecular Formula | C20H25NOS |
| Molecular Weight | 327.49 g/mol |
| Exact Mass | 327.17 |
| IUPAC Name | N-[2-[(4-ethyl-2,5-dimethylphenoxy)methyl]phenyl]propanethioamide |
| SMILES | CCC(=S)Nc1ccccc1COc1cc(C)c(CC)cc1C |
| InChI | InChI=1S/C20H25NOS/c1-5-16-11-15(4)19(12-14(16)3)22-13-17-9-7-8-10-18(17)21-20(23)6-2/h7-12H,5-6,13H2,1-4H3,(H,21,23) |
| InChIKey | JWKAPLINQFPPFC-UHFFFAOYSA-N |
| XLogP | 5.59 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.49 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|