C22H27NOS — CID 129039138
N-[3-cyclopropyl-2-[(2,4,5-trimethylphenoxy)methyl]phenyl]propanethioamide (PubChem CID 129039138) has the molecular formula C22H27NOS and a molecular weight of 353.53 g/mol. Its IUPAC name is N-[3-cyclopropyl-2-[(2,4,5-trimethylphenoxy)methyl]phenyl]propanethioamide.
| Compound Name | N-[3-cyclopropyl-2-[(2,4,5-trimethylphenoxy)methyl]phenyl]propanethioamide |
|---|---|
| PubChem CID | 129039138 |
| Molecular Formula | C22H27NOS |
| Molecular Weight | 353.53 g/mol |
| Exact Mass | 353.18 |
| IUPAC Name | N-[3-cyclopropyl-2-[(2,4,5-trimethylphenoxy)methyl]phenyl]propanethioamide |
| SMILES | CCC(=S)Nc1cccc(C2CC2)c1COc1cc(C)c(C)cc1C |
| InChI | InChI=1S/C22H27NOS/c1-5-22(25)23-20-8-6-7-18(17-9-10-17)19(20)13-24-21-12-15(3)14(2)11-16(21)4/h6-8,11-12,17H,5,9-10,13H2,1-4H3,(H,23,25) |
| InChIKey | PRAUPXTZNUNCDO-UHFFFAOYSA-N |
| XLogP | 6.22 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.53 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|