C21H26N2O3 — CID 129039023
1-[3-cyclopropyl-2-[(2,4,5-trimethylphenoxy)methyl]phenyl]-1-hydroxy-3-methylurea (PubChem CID 129039023) has the molecular formula C21H26N2O3 and a molecular weight of 354.45 g/mol. Its IUPAC name is 1-[3-cyclopropyl-2-[(2,4,5-trimethylphenoxy)methyl]phenyl]-1-hydroxy-3-methylurea.
| Compound Name | 1-[3-cyclopropyl-2-[(2,4,5-trimethylphenoxy)methyl]phenyl]-1-hydroxy-3-methylurea |
|---|---|
| PubChem CID | 129039023 |
| Molecular Formula | C21H26N2O3 |
| Molecular Weight | 354.45 g/mol |
| Exact Mass | 354.19 |
| IUPAC Name | 1-[3-cyclopropyl-2-[(2,4,5-trimethylphenoxy)methyl]phenyl]-1-hydroxy-3-methylurea |
| SMILES | CNC(=O)N(O)c1cccc(C2CC2)c1COc1cc(C)c(C)cc1C |
| InChI | InChI=1S/C21H26N2O3/c1-13-10-15(3)20(11-14(13)2)26-12-18-17(16-8-9-16)6-5-7-19(18)23(25)21(24)22-4/h5-7,10-11,16,25H,8-9,12H2,1-4H3,(H,22,24) |
| InChIKey | KZKBCCOLPLXALA-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 61.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.45 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|