C18H21FN2O4 — CID 144932805
1-[2-[(4-fluoro-2,5-dimethylphenoxy)methyl]-3-methoxyphenyl]-1-hydroxy-3-methylurea (PubChem CID 144932805) has the molecular formula C18H21FN2O4 and a molecular weight of 348.37 g/mol. Its IUPAC name is 1-[2-[(4-fluoro-2,5-dimethylphenoxy)methyl]-3-methoxyphenyl]-1-hydroxy-3-methylurea.
| Compound Name | 1-[2-[(4-fluoro-2,5-dimethylphenoxy)methyl]-3-methoxyphenyl]-1-hydroxy-3-methylurea |
|---|---|
| PubChem CID | 144932805 |
| Molecular Formula | C18H21FN2O4 |
| Molecular Weight | 348.37 g/mol |
| Exact Mass | 348.15 |
| IUPAC Name | 1-[2-[(4-fluoro-2,5-dimethylphenoxy)methyl]-3-methoxyphenyl]-1-hydroxy-3-methylurea |
| SMILES | CNC(=O)N(O)c1cccc(OC)c1COc1cc(C)c(F)cc1C |
| InChI | InChI=1S/C18H21FN2O4/c1-11-9-17(12(2)8-14(11)19)25-10-13-15(21(23)18(22)20-3)6-5-7-16(13)24-4/h5-9,23H,10H2,1-4H3,(H,20,22) |
| InChIKey | ARYFINGSLBIYPQ-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 71.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.37 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|