C17H18FNO3S — CID 129038985
O-methyl N-[2-[(2,4-dimethylphenoxy)methyl]-3-fluorophenyl]-N-hydroxycarbamothioate (PubChem CID 129038985) has the molecular formula C17H18FNO3S and a molecular weight of 335.40 g/mol. Its IUPAC name is O-methyl N-[2-[(2,4-dimethylphenoxy)methyl]-3-fluorophenyl]-N-hydroxycarbamothioate.
| Compound Name | O-methyl N-[2-[(2,4-dimethylphenoxy)methyl]-3-fluorophenyl]-N-hydroxycarbamothioate |
|---|---|
| PubChem CID | 129038985 |
| Molecular Formula | C17H18FNO3S |
| Molecular Weight | 335.40 g/mol |
| Exact Mass | 335.10 |
| IUPAC Name | O-methyl N-[2-[(2,4-dimethylphenoxy)methyl]-3-fluorophenyl]-N-hydroxycarbamothioate |
| SMILES | COC(=S)N(O)c1cccc(F)c1COc1ccc(C)cc1C |
| InChI | InChI=1S/C17H18FNO3S/c1-11-7-8-16(12(2)9-11)22-10-13-14(18)5-4-6-15(13)19(20)17(23)21-3/h4-9,20H,10H2,1-3H3 |
| InChIKey | OXEDWZXNIINDPT-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 41.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.40 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|