C18H21NO3S — CID 126588495
O-methyl N-[2-[(4-ethyl-2-methylphenoxy)methyl]phenyl]-N-hydroxycarbamothioate (PubChem CID 126588495) has the molecular formula C18H21NO3S and a molecular weight of 331.44 g/mol. Its IUPAC name is O-methyl N-[2-[(4-ethyl-2-methylphenoxy)methyl]phenyl]-N-hydroxycarbamothioate.
| Compound Name | O-methyl N-[2-[(4-ethyl-2-methylphenoxy)methyl]phenyl]-N-hydroxycarbamothioate |
|---|---|
| PubChem CID | 126588495 |
| Molecular Formula | C18H21NO3S |
| Molecular Weight | 331.44 g/mol |
| Exact Mass | 331.12 |
| IUPAC Name | O-methyl N-[2-[(4-ethyl-2-methylphenoxy)methyl]phenyl]-N-hydroxycarbamothioate |
| SMILES | CCc1ccc(OCc2ccccc2N(O)C(=S)OC)c(C)c1 |
| InChI | InChI=1S/C18H21NO3S/c1-4-14-9-10-17(13(2)11-14)22-12-15-7-5-6-8-16(15)19(20)18(23)21-3/h5-11,20H,4,12H2,1-3H3 |
| InChIKey | UJNLOJATNLODHA-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 41.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.44 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|